C28H28N4O3S — CID 10185400
N-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine (PubChem CID 10185400) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine.
| Compound Name | N-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10185400 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine |
| SMILES | COc1cc(NCCCNCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C28H28N4O3S/c1-35-27-18-28(31-25-14-7-5-13-24(25)27)30-17-9-16-29-19-21-20-32(26-15-8-6-12-23(21)26)36(33,34)22-10-3-2-4-11-22/h2-8,10-15,18,20,29H,9,16-17,19H2,1H3,(H,30,31) |
| InChIKey | WHXAWKLKHDULNZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|