C37H34N6O2 — CID 10188786
3-[1-[3-(4-methylpiperazin-1-yl)propyl]indazol-3-yl]-4-(1-naphthalen-2-ylindol-3-yl)pyrrole-2,5-dione (PubChem CID 10188786) has the molecular formula C37H34N6O2 and a molecular weight of 594.72 g/mol. Its IUPAC name is 3-[1-[3-(4-methylpiperazin-1-yl)propyl]indazol-3-yl]-4-(1-naphthalen-2-ylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(4-methylpiperazin-1-yl)propyl]indazol-3-yl]-4-(1-naphthalen-2-ylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10188786 |
| Molecular Formula | C37H34N6O2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 3-[1-[3-(4-methylpiperazin-1-yl)propyl]indazol-3-yl]-4-(1-naphthalen-2-ylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CN1CCN(CCCn2nc(C3=C(c4cn(-c5ccc6ccccc6c5)c5ccccc45)C(=O)NC3=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C37H34N6O2/c1-40-19-21-41(22-20-40)17-8-18-43-32-14-7-5-12-29(32)35(39-43)34-33(36(44)38-37(34)45)30-24-42(31-13-6-4-11-28(30)31)27-16-15-25-9-2-3-10-26(25)23-27/h2-7,9-16,23-24H,8,17-22H2,1H3,(H,38,44,45) |
| InChIKey | VJVSHXVHOJVSOB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|