C46H54N2O6 — CID 10190515
[3-(4-benzylpiperidine-1-carbonyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-(4-benzylpiperidin-1-yl)methanone (PubChem CID 10190515) has the molecular formula C46H54N2O6 and a molecular weight of 730.95 g/mol. Its IUPAC name is [3-(4-benzylpiperidine-1-carbonyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-(4-benzylpiperidin-1-yl)methanone.
| Compound Name | [3-(4-benzylpiperidine-1-carbonyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-(4-benzylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 10190515 |
| Molecular Formula | C46H54N2O6 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | [3-(4-benzylpiperidine-1-carbonyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-(4-benzylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(C2c3cc(OC)c(OC)cc3CC(C(=O)N3CCC(Cc4ccccc4)CC3)C2C(=O)N2CCC(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C46H54N2O6/c1-51-39-16-15-35(28-40(39)52-2)43-37-30-42(54-4)41(53-3)29-36(37)27-38(45(49)47-21-17-33(18-22-47)25-31-11-7-5-8-12-31)44(43)46(50)48-23-19-34(20-24-48)26-32-13-9-6-10-14-32/h5-16,28-30,33-34,38,43-44H,17-27H2,1-4H3 |
| InChIKey | STXFPYWKHJRYEA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |