C20H19F6N2O5P — CID 10191287
[(4R)-4-[[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid (PubChem CID 10191287) has the molecular formula C20H19F6N2O5P and a molecular weight of 512.34 g/mol. Its IUPAC name is [(4R)-4-[[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid.
| Compound Name | [(4R)-4-[[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 10191287 |
| Molecular Formula | C20H19F6N2O5P |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | [(4R)-4-[[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid |
| SMILES | C[C@H](OC[C@@]1(c2ccccc2)CN(P(=O)(O)O)C(=O)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F6N2O5P/c1-12(13-7-15(19(21,22)23)9-16(8-13)20(24,25)26)33-11-18(14-5-3-2-4-6-14)10-28(17(29)27-18)34(30,31)32/h2-9,12H,10-11H2,1H3,(H,27,29)(H2,30,31,32)/t12-,18+/m0/s1 |
| InChIKey | VTYRBYWTXHMIED-KPZWWZAWSA-N |
| XLogP | 4.82 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|