C24H22F6N2O3 — CID 20774493
2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-7-methyl-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 20774493) has the molecular formula C24H22F6N2O3 and a molecular weight of 500.44 g/mol. Its IUPAC name is 2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-7-methyl-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-7-methyl-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 20774493 |
| Molecular Formula | C24H22F6N2O3 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-7-methyl-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | CC(OCC1(c2ccccc2)CC2(C1)NC(=O)N(C)C2=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F6N2O3/c1-14(15-8-17(23(25,26)27)10-18(9-15)24(28,29)30)35-13-21(16-6-4-3-5-7-16)11-22(12-21)19(33)32(2)20(34)31-22/h3-10,14H,11-13H2,1-2H3,(H,31,34) |
| InChIKey | ZTCDETKVYPFKRC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|