C25H28F6N2O2 — CID 142807982
N-[[3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(ethylamino)-3-phenylcyclobutyl]methyl]formamide (PubChem CID 142807982) has the molecular formula C25H28F6N2O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is N-[[3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(ethylamino)-3-phenylcyclobutyl]methyl]formamide.
| Compound Name | N-[[3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(ethylamino)-3-phenylcyclobutyl]methyl]formamide |
|---|---|
| PubChem CID | 142807982 |
| Molecular Formula | C25H28F6N2O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-[[3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(ethylamino)-3-phenylcyclobutyl]methyl]formamide |
| SMILES | CCNC1(CNC=O)CC(CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)C1 |
| InChI | InChI=1S/C25H28F6N2O2/c1-3-33-23(14-32-16-34)12-22(13-23,19-7-5-4-6-8-19)15-35-17(2)18-9-20(24(26,27)28)11-21(10-18)25(29,30)31/h4-11,16-17,33H,3,12-15H2,1-2H3,(H,32,34)/t17-,22?,23?/m1/s1 |
| InChIKey | YSAPUPVYWLLWOO-UIFUMHDPSA-N |
| XLogP | 5.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|