C23H22F6N2O2 — CID 89058370
N-(aminomethylidene)-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutane-1-carboxamide (PubChem CID 89058370) has the molecular formula C23H22F6N2O2 and a molecular weight of 472.43 g/mol. Its IUPAC name is N-(aminomethylidene)-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutane-1-carboxamide.
| Compound Name | N-(aminomethylidene)-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 89058370 |
| Molecular Formula | C23H22F6N2O2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-(aminomethylidene)-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutane-1-carboxamide |
| SMILES | C[C@@H](OCC1(c2ccccc2)CC(C(=O)/N=C/N)C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F6N2O2/c1-14(15-7-18(22(24,25)26)9-19(8-15)23(27,28)29)33-12-21(17-5-3-2-4-6-17)10-16(11-21)20(32)31-13-30/h2-9,13-14,16H,10-12H2,1H3,(H2,30,31,32)/t14-,16?,21?/m1/s1 |
| InChIKey | WFKHFLIIKYUKRQ-HXJYWVFZSA-N |
| XLogP | 5.66 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|