C28H25F6NO — CID 162579019
N-benzyl-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutan-1-imine (PubChem CID 162579019) has the molecular formula C28H25F6NO and a molecular weight of 505.50 g/mol. Its IUPAC name is N-benzyl-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutan-1-imine.
| Compound Name | N-benzyl-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutan-1-imine |
|---|---|
| PubChem CID | 162579019 |
| Molecular Formula | C28H25F6NO |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-benzyl-3-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-phenylcyclobutan-1-imine |
| SMILES | C[C@@H](OCC1(c2ccccc2)CC(=NCc2ccccc2)C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F6NO/c1-19(21-12-23(27(29,30)31)14-24(13-21)28(32,33)34)36-18-26(22-10-6-3-7-11-22)15-25(16-26)35-17-20-8-4-2-5-9-20/h2-14,19H,15-18H2,1H3/b35-25-/t19-,26?/m1/s1 |
| InChIKey | AQJDYHUINHUTJI-YKQLMWBFSA-N |
| XLogP | 8.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|