C23H20F6N2O3 — CID 10128095
2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 10128095) has the molecular formula C23H20F6N2O3 and a molecular weight of 486.41 g/mol. Its IUPAC name is 2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 10128095 |
| Molecular Formula | C23H20F6N2O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | C[C@@H](OCC1(c2ccccc2)CC2(C1)NC(=O)NC2=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F6N2O3/c1-13(14-7-16(22(24,25)26)9-17(8-14)23(27,28)29)34-12-20(15-5-3-2-4-6-15)10-21(11-20)18(32)30-19(33)31-21/h2-9,13H,10-12H2,1H3,(H2,30,31,32,33)/t13-,20?,21?/m1/s1 |
| InChIKey | YFJSIPFLGBXTQD-ZJDGCUJOSA-N |
| XLogP | 5.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|