C24H26F6O — CID 157114936
methane;1-[(1R)-1-[[(1S)-1-phenylcyclohex-3-en-1-yl]methoxy]ethyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 157114936) has the molecular formula C24H26F6O and a molecular weight of 444.46 g/mol. Its IUPAC name is methane;1-[(1R)-1-[[(1S)-1-phenylcyclohex-3-en-1-yl]methoxy]ethyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | methane;1-[(1R)-1-[[(1S)-1-phenylcyclohex-3-en-1-yl]methoxy]ethyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 157114936 |
| Molecular Formula | C24H26F6O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | methane;1-[(1R)-1-[[(1S)-1-phenylcyclohex-3-en-1-yl]methoxy]ethyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | C.C[C@@H](OC[C@]1(c2ccccc2)CC=CCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F6O.CH4/c1-16(17-12-19(22(24,25)26)14-20(13-17)23(27,28)29)30-15-21(10-6-3-7-11-21)18-8-4-2-5-9-18;/h2-6,8-9,12-14,16H,7,10-11,15H2,1H3;1H4/t16-,21+;/m1./s1 |
| InChIKey | AHHAVBSPPAKGRP-HNIQDJCDSA-N |
| XLogP | 8.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|