C19H24Cl2N4O4 — CID 10195006
6-[(3,4-dichlorophenyl)methylamino]-3-[2-(2-morpholin-4-ylethoxy)ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 10195006) has the molecular formula C19H24Cl2N4O4 and a molecular weight of 443.33 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methylamino]-3-[2-(2-morpholin-4-ylethoxy)ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(3,4-dichlorophenyl)methylamino]-3-[2-(2-morpholin-4-ylethoxy)ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10195006 |
| Molecular Formula | C19H24Cl2N4O4 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methylamino]-3-[2-(2-morpholin-4-ylethoxy)ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)n1CCOCCN1CCOCC1 |
| InChI | InChI=1S/C19H24Cl2N4O4/c20-15-2-1-14(11-16(15)21)13-22-17-12-18(26)25(19(27)23-17)6-10-29-9-5-24-3-7-28-8-4-24/h1-2,11-12,22H,3-10,13H2,(H,23,27) |
| InChIKey | JJTTXTDWSAFSIG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|