C23H24N4O5S2 — CID 10195930
2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1-pyridin-3-ylsulfonylbenzimidazole (PubChem CID 10195930) has the molecular formula C23H24N4O5S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1-pyridin-3-ylsulfonylbenzimidazole.
| Compound Name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1-pyridin-3-ylsulfonylbenzimidazole |
|---|---|
| PubChem CID | 10195930 |
| Molecular Formula | C23H24N4O5S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1-pyridin-3-ylsulfonylbenzimidazole |
| SMILES | COCCCOc1ccnc(CS(=O)c2nc3ccccc3n2S(=O)(=O)c2cccnc2)c1C |
| InChI | InChI=1S/C23H24N4O5S2/c1-17-20(25-12-10-22(17)32-14-6-13-31-2)16-33(28)23-26-19-8-3-4-9-21(19)27(23)34(29,30)18-7-5-11-24-15-18/h3-5,7-12,15H,6,13-14,16H2,1-2H3 |
| InChIKey | MNPWAIPAQHKPKZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|