C24H23Cl2N3O5S2 — CID 101398602
1-(2,5-dichlorophenyl)sulfonyl-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazole (PubChem CID 101398602) has the molecular formula C24H23Cl2N3O5S2 and a molecular weight of 568.50 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazole.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazole |
|---|---|
| PubChem CID | 101398602 |
| Molecular Formula | C24H23Cl2N3O5S2 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazole |
| SMILES | COCCCOc1ccnc(CS(=O)c2nc3ccccc3n2S(=O)(=O)c2cc(Cl)ccc2Cl)c1C |
| InChI | InChI=1S/C24H23Cl2N3O5S2/c1-16-20(27-11-10-22(16)34-13-5-12-33-2)15-35(30)24-28-19-6-3-4-7-21(19)29(24)36(31,32)23-14-17(25)8-9-18(23)26/h3-4,6-11,14H,5,12-13,15H2,1-2H3 |
| InChIKey | JGOOKNAWVZALCD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|