C33H36N2O3S — CID 10196390
(5Z)-5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 10196390) has the molecular formula C33H36N2O3S and a molecular weight of 540.73 g/mol. Its IUPAC name is (5Z)-5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10196390 |
| Molecular Formula | C33H36N2O3S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | (5Z)-5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-3-(2-pyridin-2-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCc3ccccn3)C2=O)cc1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H36N2O3S/c1-21-17-26-27(33(4,5)14-13-32(26,2)3)20-24(21)25-18-22(10-11-28(25)38-6)19-29-30(36)35(31(37)39-29)16-12-23-9-7-8-15-34-23/h7-11,15,17-20H,12-14,16H2,1-6H3/b29-19- |
| InChIKey | CKOFEZLNKCDJAE-CEUNXORHSA-N |
| XLogP | 7.69 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|