C5H6O3 — CID 10197660
4,5-dihydroxycyclopent-2-en-1-one (PubChem CID 10197660) has the molecular formula C5H6O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is 4,5-dihydroxycyclopent-2-en-1-one.
| Compound Name | 4,5-dihydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10197660 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 4,5-dihydroxycyclopent-2-en-1-one |
| SMILES | O=C1C=CC(O)C1O |
| InChI | InChI=1S/C5H6O3/c6-3-1-2-4(7)5(3)8/h1-3,5-6,8H |
| InChIKey | HLOLRONOOCGTRG-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |