About (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one
(4R,5S)-4,5-dihydroxycyclopent-2-en-1-one (PubChem CID 59934929) has the molecular formula C5H6O3
and a molecular weight of 114.10 g/mol. Its IUPAC name is (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one |
| PubChem CID | 59934929 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one |
| SMILES | O=C1C=C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H6O3/c6-3-1-2-4(7)5(3)8/h1-3,5-6,8H/t3-,5+/m1/s1 |
| InChIKey | HLOLRONOOCGTRG-WUJLRWPWSA-N |
| XLogP | -1.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one?
The IUPAC name of (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one (CID 59934929) is (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one.
What is the SMILES notation for (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one?
The canonical SMILES for (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one is O=C1C=C[C@@H](O)[C@@H]1O.
What is the InChIKey of (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one?
The InChIKey is HLOLRONOOCGTRG-WUJLRWPWSA-N. The full InChI is InChI=1S/C5H6O3/c6-3-1-2-4(7)5(3)8/h1-3,5-6,8H/t3-,5+/m1/s1.
What are the key properties of (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one?
(4R,5S)-4,5-dihydroxycyclopent-2-en-1-one has a molecular weight of 114.10 g/mol, XLogP of -1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4,5-dihydroxycyclopent-2-en-1-one is sourced from PubChem (CID 59934929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).