C12H23N3O2 — CID 10198675
(2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid (PubChem CID 10198675) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is (2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid.
| Compound Name | (2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 10198675 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid |
| SMILES | NC1=N[C@@H](CCCC[C@@H](N)C(=O)O)CCCC1 |
| InChI | InChI=1S/C12H23N3O2/c13-10(12(16)17)7-3-1-5-9-6-2-4-8-11(14)15-9/h9-10H,1-8,13H2,(H2,14,15)(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | GFTXSVYMUGOAMJ-VHSXEESVSA-N |
| XLogP | 1.26 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|