C13H25N3O2 — CID 142831938
2-amino-6-[(2R)-8-amino-2,3,4,5,6,7-hexahydroazocin-2-yl]hexanoic acid (PubChem CID 142831938) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-amino-6-[(2R)-8-amino-2,3,4,5,6,7-hexahydroazocin-2-yl]hexanoic acid.
| Compound Name | 2-amino-6-[(2R)-8-amino-2,3,4,5,6,7-hexahydroazocin-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 142831938 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2-amino-6-[(2R)-8-amino-2,3,4,5,6,7-hexahydroazocin-2-yl]hexanoic acid |
| SMILES | N/C1=N/[C@@H](CCCCC(N)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H25N3O2/c14-11(13(17)18)8-5-4-7-10-6-2-1-3-9-12(15)16-10/h10-11H,1-9,14H2,(H2,15,16)(H,17,18)/t10-,11?/m1/s1 |
| InChIKey | QBLOOVYOWTXGQA-NFJWQWPMSA-N |
| XLogP | 1.65 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|