C23H43Cl2N3O3 — CID 159538330
(2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid;2-pent-4-enylcyclohexan-1-one;dihydrochloride (PubChem CID 159538330) has the molecular formula C23H43Cl2N3O3 and a molecular weight of 480.52 g/mol. Its IUPAC name is (2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid;2-pent-4-enylcyclohexan-1-one;dihydrochloride.
| Compound Name | (2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid;2-pent-4-enylcyclohexan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 159538330 |
| Molecular Formula | C23H43Cl2N3O3 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (2R)-2-amino-6-[(2S)-7-amino-3,4,5,6-tetrahydro-2H-azepin-2-yl]hexanoic acid;2-pent-4-enylcyclohexan-1-one;dihydrochloride |
| SMILES | C=CCCCC1CCCCC1=O.Cl.Cl.NC1=N[C@@H](CCCC[C@@H](N)C(=O)O)CCCC1 |
| InChI | InChI=1S/C12H23N3O2.C11H18O.2ClH/c13-10(12(16)17)7-3-1-5-9-6-2-4-8-11(14)15-9;1-2-3-4-7-10-8-5-6-9-11(10)12;;/h9-10H,1-8,13H2,(H2,14,15)(H,16,17);2,10H,1,3-9H2;2*1H/t9-,10+;;;/m0.../s1 |
| InChIKey | AJZYKJSCLAEIHE-GKMSJBIESA-N |
| XLogP | 5.20 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|