C12H12N4O2 — CID 10198727
3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione (PubChem CID 10198727) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione.
| Compound Name | 3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
|---|---|
| PubChem CID | 10198727 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
| SMILES | CCc1nc(C)c2c(=O)[nH]c3ccc(=O)[nH]c3n12 |
| InChI | InChI=1S/C12H12N4O2/c1-3-8-13-6(2)10-12(18)14-7-4-5-9(17)15-11(7)16(8)10/h4-5H,3H2,1-2H3,(H,14,18)(H,15,17) |
| InChIKey | VVJQZMULBFBNPZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |