About 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane]
6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] (PubChem CID 10198760) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] |
| PubChem CID | 10198760 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] |
| SMILES | CCOc1ccc2c(c1)CCC1(CCCCC1)N2 |
| InChI | InChI=1S/C16H23NO/c1-2-18-14-6-7-15-13(12-14)8-11-16(17-15)9-4-3-5-10-16/h6-7,12,17H,2-5,8-11H2,1H3 |
| InChIKey | IJZSSNQAEBWDLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane]?
The IUPAC name of 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] (CID 10198760) is 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane].
What is the SMILES notation for 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane]?
The canonical SMILES for 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] is CCOc1ccc2c(c1)CCC1(CCCCC1)N2.
What is the InChIKey of 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane]?
The InChIKey is IJZSSNQAEBWDLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-2-18-14-6-7-15-13(12-14)8-11-16(17-15)9-4-3-5-10-16/h6-7,12,17H,2-5,8-11H2,1H3.
What are the key properties of 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane]?
6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] has a molecular weight of 245.37 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxyspiro[3,4-dihydro-1H-quinoline-2,1'-cyclohexane] is sourced from PubChem (CID 10198760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).