C16H9F3N2O4S — CID 10199889
2-[(Z)-[3,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrazolidin-4-ylidene]methyl]thiophene-3-carboxylic acid (PubChem CID 10199889) has the molecular formula C16H9F3N2O4S and a molecular weight of 382.32 g/mol. Its IUPAC name is 2-[(Z)-[3,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrazolidin-4-ylidene]methyl]thiophene-3-carboxylic acid.
| Compound Name | 2-[(Z)-[3,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrazolidin-4-ylidene]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 10199889 |
| Molecular Formula | C16H9F3N2O4S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-[(Z)-[3,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrazolidin-4-ylidene]methyl]thiophene-3-carboxylic acid |
| SMILES | O=C1NN(c2cccc(C(F)(F)F)c2)C(=O)/C1=C\c1sccc1C(=O)O |
| InChI | InChI=1S/C16H9F3N2O4S/c17-16(18,19)8-2-1-3-9(6-8)21-14(23)11(13(22)20-21)7-12-10(15(24)25)4-5-26-12/h1-7H,(H,20,22)(H,24,25)/b11-7- |
| InChIKey | QGQTXDNUOODHGQ-XFFZJAGNSA-N |
| XLogP | 2.93 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|