C27H44O2Si — CID 102000909
[(6E)-6-[10-tert-butyl-3,3-dimethyl-9-[(Z)-prop-1-enyl]-2,4-dioxaspiro[5.5]undec-9-en-8-ylidene]hex-1-ynyl]-trimethylsilane (PubChem CID 102000909) has the molecular formula C27H44O2Si and a molecular weight of 428.73 g/mol. Its IUPAC name is [(6E)-6-[10-tert-butyl-3,3-dimethyl-9-[(Z)-prop-1-enyl]-2,4-dioxaspiro[5.5]undec-9-en-8-ylidene]hex-1-ynyl]-trimethylsilane.
| Compound Name | [(6E)-6-[10-tert-butyl-3,3-dimethyl-9-[(Z)-prop-1-enyl]-2,4-dioxaspiro[5.5]undec-9-en-8-ylidene]hex-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 102000909 |
| Molecular Formula | C27H44O2Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | [(6E)-6-[10-tert-butyl-3,3-dimethyl-9-[(Z)-prop-1-enyl]-2,4-dioxaspiro[5.5]undec-9-en-8-ylidene]hex-1-ynyl]-trimethylsilane |
| SMILES | C/C=C\C1=C(C(C)(C)C)CC2(COC(C)(C)OC2)C/C1=C\CCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C27H44O2Si/c1-10-15-23-22(16-13-11-12-14-17-30(7,8)9)18-27(19-24(23)25(2,3)4)20-28-26(5,6)29-21-27/h10,15-16H,11-13,18-21H2,1-9H3/b15-10-,22-16+ |
| InChIKey | SUCUVLVIGIIHKV-VCYHOFDLSA-N |
| XLogP | 7.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|