C22H38O2Si — CID 135047946
3-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane (PubChem CID 135047946) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is 3-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane.
| Compound Name | 3-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 135047946 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 3-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane |
| SMILES | CCC=C=C(CC1(CC#C[Si](C)(C)C)COC(C)(C)OC1)C(C)(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-10-11-13-19(20(2,3)4)16-22(14-12-15-25(7,8)9)17-23-21(5,6)24-18-22/h11H,10,14,16-18H2,1-9H3 |
| InChIKey | MAMVAUFTXTVOMB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|