C23H34O2 — CID 102123510
5-(2-tert-butyl-4-methylnona-2,3-dien-8-ynyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane (PubChem CID 102123510) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 5-(2-tert-butyl-4-methylnona-2,3-dien-8-ynyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane.
| Compound Name | 5-(2-tert-butyl-4-methylnona-2,3-dien-8-ynyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane |
|---|---|
| PubChem CID | 102123510 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 5-(2-tert-butyl-4-methylnona-2,3-dien-8-ynyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane |
| SMILES | C#CCCCC(C)=C=C(CC1(CC#C)COC(C)(C)OC1)C(C)(C)C |
| InChI | InChI=1S/C23H34O2/c1-9-11-12-13-19(3)15-20(21(4,5)6)16-23(14-10-2)17-24-22(7,8)25-18-23/h1-2H,11-14,16-18H2,3-8H3 |
| InChIKey | FQURVVJSFRNGHW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|