C27H44O2Si — CID 102000907
8-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]octa-1,6-diynyl-trimethylsilane (PubChem CID 102000907) has the molecular formula C27H44O2Si and a molecular weight of 428.73 g/mol. Its IUPAC name is 8-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]octa-1,6-diynyl-trimethylsilane.
| Compound Name | 8-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]octa-1,6-diynyl-trimethylsilane |
|---|---|
| PubChem CID | 102000907 |
| Molecular Formula | C27H44O2Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 8-[5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]octa-1,6-diynyl-trimethylsilane |
| SMILES | CCC=C=C(CC1(CC#CCCCC#C[Si](C)(C)C)COC(C)(C)OC1)C(C)(C)C |
| InChI | InChI=1S/C27H44O2Si/c1-10-11-18-24(25(2,3)4)21-27(22-28-26(5,6)29-23-27)19-16-14-12-13-15-17-20-30(7,8)9/h11H,10,12-13,15,19,21-23H2,1-9H3 |
| InChIKey | OOEHVUGJKUKZOG-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|