C25H38O2 — CID 102123511
5-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2,2-dimethyl-5-nona-2,8-diynyl-1,3-dioxane (PubChem CID 102123511) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 5-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2,2-dimethyl-5-nona-2,8-diynyl-1,3-dioxane.
| Compound Name | 5-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2,2-dimethyl-5-nona-2,8-diynyl-1,3-dioxane |
|---|---|
| PubChem CID | 102123511 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 5-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2,2-dimethyl-5-nona-2,8-diynyl-1,3-dioxane |
| SMILES | C#CCCCCC#CCC1(CC(=C=C(C)C)C(C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C25H38O2/c1-9-10-11-12-13-14-15-16-25(19-26-24(7,8)27-20-25)18-22(17-21(2)3)23(4,5)6/h1H,10-13,16,18-20H2,2-8H3 |
| InChIKey | GKKNLBAPPHKHBJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|