C20H36O2Si — CID 135011635
[6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-ynyl]-trimethylsilane (PubChem CID 135011635) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is [6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-ynyl]-trimethylsilane.
| Compound Name | [6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 135011635 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | [6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-ynyl]-trimethylsilane |
| SMILES | CC=C=C(CC(CC#C[Si](C)(C)C)(COC)COC)C(C)(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-10-12-18(19(2,3)4)15-20(16-21-5,17-22-6)13-11-14-23(7,8)9/h10H,13,15-17H2,1-9H3 |
| InChIKey | GHEFRVVPESWUTI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|