C17H28O2 — CID 24865694
6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-yne (PubChem CID 24865694) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-yne.
| Compound Name | 6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-yne |
|---|---|
| PubChem CID | 24865694 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 6-tert-butyl-4,4-bis(methoxymethyl)nona-6,7-dien-1-yne |
| SMILES | C#CCC(COC)(COC)CC(=C=CC)C(C)(C)C |
| InChI | InChI=1S/C17H28O2/c1-8-10-15(16(3,4)5)12-17(11-9-2,13-18-6)14-19-7/h2,8H,11-14H2,1,3-7H3 |
| InChIKey | IIMVVMDXOCQSDM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|