C14H22O2 — CID 102217715
4,4-bis(methoxymethyl)-6-methylnona-6,7-dien-1-yne (PubChem CID 102217715) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 4,4-bis(methoxymethyl)-6-methylnona-6,7-dien-1-yne.
| Compound Name | 4,4-bis(methoxymethyl)-6-methylnona-6,7-dien-1-yne |
|---|---|
| PubChem CID | 102217715 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 4,4-bis(methoxymethyl)-6-methylnona-6,7-dien-1-yne |
| SMILES | C#CCC(COC)(COC)CC(C)=C=CC |
| InChI | InChI=1S/C14H22O2/c1-6-8-13(3)10-14(9-7-2,11-15-4)12-16-5/h2,6H,9-12H2,1,3-5H3 |
| InChIKey | VQIWIBMLRNHMHP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|