C17H28O2 — CID 71367519
8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne (PubChem CID 71367519) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne.
| Compound Name | 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne |
|---|---|
| PubChem CID | 71367519 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne |
| SMILES | C#CCC(COC)(COC)CC(C)=C=C(CC)CC |
| InChI | InChI=1S/C17H28O2/c1-7-10-17(13-18-5,14-19-6)12-15(4)11-16(8-2)9-3/h1H,8-10,12-14H2,2-6H3 |
| InChIKey | GREORTBJSLRRKX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|