About 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne
8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne (PubChem CID 71367519) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne.
Molecular Properties
| Compound Name | 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne |
| PubChem CID | 71367519 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne |
| SMILES | C#CCC(COC)(COC)CC(C)=C=C(CC)CC |
| InChI | InChI=1S/C17H28O2/c1-7-10-17(13-18-5,14-19-6)12-15(4)11-16(8-2)9-3/h1H,8-10,12-14H2,2-6H3 |
| InChIKey | GREORTBJSLRRKX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne?
The IUPAC name of 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne (CID 71367519) is 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne.
What is the SMILES notation for 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne?
The canonical SMILES for 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne is C#CCC(COC)(COC)CC(C)=C=C(CC)CC.
What is the InChIKey of 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne?
The InChIKey is GREORTBJSLRRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-7-10-17(13-18-5,14-19-6)12-15(4)11-16(8-2)9-3/h1H,8-10,12-14H2,2-6H3.
What are the key properties of 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne?
8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne has a molecular weight of 264.41 g/mol, XLogP of 3.97, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-4,4-bis(methoxymethyl)-6-methyldeca-6,7-dien-1-yne is sourced from PubChem (CID 71367519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).