C24H42O3Si — CID 25215765
tert-butyl-[4-[5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]but-2-ynoxy]-dimethylsilane (PubChem CID 25215765) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is tert-butyl-[4-[5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]but-2-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]but-2-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 25215765 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | tert-butyl-[4-[5-(5,5-dimethylhexa-2,3-dienyl)-2,2-dimethyl-1,3-dioxan-5-yl]but-2-ynoxy]-dimethylsilane |
| SMILES | CC(C)(C)C=C=CCC1(CC#CCO[Si](C)(C)C(C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C24H42O3Si/c1-21(2,3)15-11-12-16-24(19-25-23(7,8)26-20-24)17-13-14-18-27-28(9,10)22(4,5)6/h12,15H,16-20H2,1-10H3 |
| InChIKey | SOJPVDKLVTVBAS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|