C15H25LiO2Si — CID 10635935
lithium 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)prop-1-ynyl-trimethylsilane (PubChem CID 10635935) has the molecular formula C15H25LiO2Si and a molecular weight of 272.39 g/mol. Its IUPAC name is lithium 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)prop-1-ynyl-trimethylsilane.
| Compound Name | lithium 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 10635935 |
| Molecular Formula | C15H25LiO2Si |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | lithium 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)prop-1-ynyl-trimethylsilane |
| SMILES | C=[C-]CC1(CC#C[Si](C)(C)C)COC(C)(C)OC1.[Li+] |
| InChI | InChI=1S/C15H25O2Si.Li/c1-7-9-15(10-8-11-18(4,5)6)12-16-14(2,3)17-13-15;/h1,9-10,12-13H2,2-6H3;/q-1;+1 |
| InChIKey | FENBEZJJSXSWND-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|