C42H40N2O8 — CID 102001346
[4-[4-(2-hexyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]phenyl] 2-hexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 102001346) has the molecular formula C42H40N2O8 and a molecular weight of 700.79 g/mol. Its IUPAC name is [4-[4-(2-hexyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]phenyl] 2-hexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[4-(2-hexyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]phenyl] 2-hexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 102001346 |
| Molecular Formula | C42H40N2O8 |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | [4-[4-(2-hexyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]phenyl] 2-hexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCCCN1C(=O)c2ccc(C(=O)Oc3ccc(-c4ccc(OC(=O)c5ccc6c(c5)C(=O)N(CCCCCC)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C42H40N2O8/c1-3-5-7-9-23-43-37(45)33-21-15-29(25-35(33)39(43)47)41(49)51-31-17-11-27(12-18-31)28-13-19-32(20-14-28)52-42(50)30-16-22-34-36(26-30)40(48)44(38(34)46)24-10-8-6-4-2/h11-22,25-26H,3-10,23-24H2,1-2H3 |
| InChIKey | DJHUAJMJVYJOEM-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|