C14H26O — CID 102001438
(1R,2S,4R)-2-[(Z)-but-1-enoxy]-1-methyl-4-propan-2-ylcyclohexane (PubChem CID 102001438) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (1R,2S,4R)-2-[(Z)-but-1-enoxy]-1-methyl-4-propan-2-ylcyclohexane.
| Compound Name | (1R,2S,4R)-2-[(Z)-but-1-enoxy]-1-methyl-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 102001438 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (1R,2S,4R)-2-[(Z)-but-1-enoxy]-1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC/C=C\O[C@H]1C[C@H](C(C)C)CC[C@H]1C |
| InChI | InChI=1S/C14H26O/c1-5-6-9-15-14-10-13(11(2)3)8-7-12(14)4/h6,9,11-14H,5,7-8,10H2,1-4H3/b9-6-/t12-,13-,14+/m1/s1 |
| InChIKey | OAITYXBFUNMKNC-XNXUKNMWSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|