C18H32O — CID 11065337
(1S,2R,4R)-4-methyl-2-[(1E,3Z)-octa-1,3-dienoxy]-1-propan-2-ylcyclohexane (PubChem CID 11065337) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (1S,2R,4R)-4-methyl-2-[(1E,3Z)-octa-1,3-dienoxy]-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-4-methyl-2-[(1E,3Z)-octa-1,3-dienoxy]-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 11065337 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (1S,2R,4R)-4-methyl-2-[(1E,3Z)-octa-1,3-dienoxy]-1-propan-2-ylcyclohexane |
| SMILES | CCCC/C=C\C=C\O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C18H32O/c1-5-6-7-8-9-10-13-19-18-14-16(4)11-12-17(18)15(2)3/h8-10,13,15-18H,5-7,11-12,14H2,1-4H3/b9-8-,13-10+/t16-,17+,18-/m1/s1 |
| InChIKey | FAUQNPOSUWXTBZ-NCDHXVQZSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|