C16H28O — CID 15449907
(1S,2R,4R)-2-[(1Z)-hexa-1,5-dienoxy]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 15449907) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(1Z)-hexa-1,5-dienoxy]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(1Z)-hexa-1,5-dienoxy]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 15449907 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (1S,2R,4R)-2-[(1Z)-hexa-1,5-dienoxy]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | C=CCC/C=C\O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C16H28O/c1-5-6-7-8-11-17-16-12-14(4)9-10-15(16)13(2)3/h5,8,11,13-16H,1,6-7,9-10,12H2,2-4H3/b11-8-/t14-,15+,16-/m1/s1 |
| InChIKey | AMRRXECZFUMOGH-CIDUYRBDSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|