C16H29BrO — CID 15530587
(1S,2R,4R)-2-[(E)-1-bromo-4-methylpent-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 15530587) has the molecular formula C16H29BrO and a molecular weight of 317.31 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(E)-1-bromo-4-methylpent-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(E)-1-bromo-4-methylpent-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 15530587 |
| Molecular Formula | C16H29BrO |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (1S,2R,4R)-2-[(E)-1-bromo-4-methylpent-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)C/C=C(/Br)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C16H29BrO/c1-11(2)6-9-16(17)18-15-10-13(5)7-8-14(15)12(3)4/h9,11-15H,6-8,10H2,1-5H3/b16-9-/t13-,14+,15-/m1/s1 |
| InChIKey | UOTBWPBVGCNTNR-DXMMMGMNSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|