C14H24Cl2Si — CID 102005546
dichloro-(2-cyclopenta-2,4-dien-1-ylpropyl)-hexylsilane (PubChem CID 102005546) has the molecular formula C14H24Cl2Si and a molecular weight of 291.34 g/mol. Its IUPAC name is dichloro-(2-cyclopenta-2,4-dien-1-ylpropyl)-hexylsilane.
| Compound Name | dichloro-(2-cyclopenta-2,4-dien-1-ylpropyl)-hexylsilane |
|---|---|
| PubChem CID | 102005546 |
| Molecular Formula | C14H24Cl2Si |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | dichloro-(2-cyclopenta-2,4-dien-1-ylpropyl)-hexylsilane |
| SMILES | CCCCCC[Si](Cl)(Cl)CC(C)C1C=CC=C1 |
| InChI | InChI=1S/C14H24Cl2Si/c1-3-4-5-8-11-17(15,16)12-13(2)14-9-6-7-10-14/h6-7,9-10,13-14H,3-5,8,11-12H2,1-2H3 |
| InChIKey | VZEJVGIHSFRFQY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|