C21H36O2Si — CID 102008284
(4aS,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-1,2,3,4b,5,6,7,8,10,10a-decahydrophenanthren-4-one (PubChem CID 102008284) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (4aS,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-1,2,3,4b,5,6,7,8,10,10a-decahydrophenanthren-4-one.
| Compound Name | (4aS,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-1,2,3,4b,5,6,7,8,10,10a-decahydrophenanthren-4-one |
|---|---|
| PubChem CID | 102008284 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (4aS,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-1,2,3,4b,5,6,7,8,10,10a-decahydrophenanthren-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCC[C@H]2[C@@]2(C)C(=O)CCC[C@H]2C1 |
| InChI | InChI=1S/C21H36O2Si/c1-20(2,3)24(5,6)23-18-14-15-10-9-13-19(22)21(15,4)17-12-8-7-11-16(17)18/h15,17H,7-14H2,1-6H3/t15-,17+,21-/m0/s1 |
| InChIKey | UOFBIJUAMPUOSB-XPIZARPCSA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|