C20H30O6 — CID 102008990
[(2S,6R)-6-acetyloxyundecan-2-yl] 2,4-dihydroxybenzoate (PubChem CID 102008990) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is [(2S,6R)-6-acetyloxyundecan-2-yl] 2,4-dihydroxybenzoate.
| Compound Name | [(2S,6R)-6-acetyloxyundecan-2-yl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 102008990 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(2S,6R)-6-acetyloxyundecan-2-yl] 2,4-dihydroxybenzoate |
| SMILES | CCCCC[C@H](CCC[C@H](C)OC(=O)c1ccc(O)cc1O)OC(C)=O |
| InChI | InChI=1S/C20H30O6/c1-4-5-6-9-17(26-15(3)21)10-7-8-14(2)25-20(24)18-12-11-16(22)13-19(18)23/h11-14,17,22-23H,4-10H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | RPYOFUHNSXBXIB-WMLDXEAASA-N |
| XLogP | 4.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|