C15H23NO4 — CID 2055324
[(2R)-4-(diethylamino)butan-2-yl] 2,4-dihydroxybenzoate (PubChem CID 2055324) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is [(2R)-4-(diethylamino)butan-2-yl] 2,4-dihydroxybenzoate.
| Compound Name | [(2R)-4-(diethylamino)butan-2-yl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 2055324 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [(2R)-4-(diethylamino)butan-2-yl] 2,4-dihydroxybenzoate |
| SMILES | CCN(CC)CC[C@@H](C)OC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H23NO4/c1-4-16(5-2)9-8-11(3)20-15(19)13-7-6-12(17)10-14(13)18/h6-7,10-11,17-18H,4-5,8-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | XYNOABBAMZJILH-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |