C21H31ClN2O2 — CID 24836627
4-(diethylamino)butan-2-yl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;hydrochloride (PubChem CID 24836627) has the molecular formula C21H31ClN2O2 and a molecular weight of 378.94 g/mol. Its IUPAC name is 4-(diethylamino)butan-2-yl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;hydrochloride.
| Compound Name | 4-(diethylamino)butan-2-yl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 24836627 |
| Molecular Formula | C21H31ClN2O2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-(diethylamino)butan-2-yl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate;hydrochloride |
| SMILES | CCN(CC)CCC(C)OC(=O)c1ccc2[nH]c3c(c2c1)CCCC3.Cl |
| InChI | InChI=1S/C21H30N2O2.ClH/c1-4-23(5-2)13-12-15(3)25-21(24)16-10-11-20-18(14-16)17-8-6-7-9-19(17)22-20;/h10-11,14-15,22H,4-9,12-13H2,1-3H3;1H |
| InChIKey | LLSGVFMOEYUTCU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|