C34H34O10 — CID 102009207
dimethyl (1R)-1-[(1S)-1,3-bis(methoxycarbonyl)-2-oxo-6-propan-2-ylazulen-1-yl]-2-oxo-6-propan-2-ylazulene-1,3-dicarboxylate (PubChem CID 102009207) has the molecular formula C34H34O10 and a molecular weight of 602.64 g/mol. Its IUPAC name is dimethyl (1R)-1-[(1S)-1,3-bis(methoxycarbonyl)-2-oxo-6-propan-2-ylazulen-1-yl]-2-oxo-6-propan-2-ylazulene-1,3-dicarboxylate.
| Compound Name | dimethyl (1R)-1-[(1S)-1,3-bis(methoxycarbonyl)-2-oxo-6-propan-2-ylazulen-1-yl]-2-oxo-6-propan-2-ylazulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102009207 |
| Molecular Formula | C34H34O10 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | dimethyl (1R)-1-[(1S)-1,3-bis(methoxycarbonyl)-2-oxo-6-propan-2-ylazulen-1-yl]-2-oxo-6-propan-2-ylazulene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=C2C=CC(C(C)C)=CC=C2[C@@](C(=O)OC)([C@]2(C(=O)OC)C(=O)C(C(=O)OC)=C3C=CC(C(C)C)=CC=C32)C1=O |
| InChI | InChI=1S/C34H34O10/c1-17(2)19-9-13-21-23(15-11-19)33(31(39)43-7,27(35)25(21)29(37)41-5)34(32(40)44-8)24-16-12-20(18(3)4)10-14-22(24)26(28(34)36)30(38)42-6/h9-18H,1-8H3/t33-,34+ |
| InChIKey | NWSZRAPZMPPPRX-AQOUDTPCSA-N |
| XLogP | 3.57 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|