C16H14O4 — CID 12827002
dimethyl (11R)-11-methyltricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate (PubChem CID 12827002) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is dimethyl (11R)-11-methyltricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate.
| Compound Name | dimethyl (11R)-11-methyltricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 12827002 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | dimethyl (11R)-11-methyltricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2=CC=C3C=CC=C1[C@@]32C |
| InChI | InChI=1S/C16H14O4/c1-16-9-5-4-6-10(16)12(14(17)19-2)13(15(18)20-3)11(16)8-7-9/h4-8H,1-3H3/t16-/m1/s1 |
| InChIKey | PKRRLULJMZHYRO-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |