methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate

C10H12O3 — CID 10965121

IUPACmethyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate
SMILESCOC(=O)C1=CC(C)(C)C=CC1=O
InChIInChI=1S/C10H12O3/c1-10(2)5-4-8(11)7(6-10)9(12)13-3/h4-6H,1-3H3
InChIKeyWJUBXRCGKAIXAC-UHFFFAOYSA-N
MW180.20 g/mol
LogP1.25
Rot. Bonds1

About methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate

methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 10965121) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate.

Molecular Properties

Compound Namemethyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate
PubChem CID10965121
Molecular FormulaC10H12O3
Molecular Weight180.20 g/mol
Exact Mass180.08
IUPAC Namemethyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate
SMILESCOC(=O)C1=CC(C)(C)C=CC1=O
InChIInChI=1S/C10H12O3/c1-10(2)5-4-8(11)7(6-10)9(12)13-3/h4-6H,1-3H3
InChIKeyWJUBXRCGKAIXAC-UHFFFAOYSA-N
XLogP1.25
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 51.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}

Analyze methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate (CID 10965121) is methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate is COC(=O)C1=CC(C)(C)C=CC1=O.
What is the InChIKey of methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate?
The InChIKey is WJUBXRCGKAIXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-10(2)5-4-8(11)7(6-10)9(12)13-3/h4-6H,1-3H3.
What are the key properties of methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate?
methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate has a molecular weight of 180.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3-dimethyl-6-oxocyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 10965121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).