About methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate
methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 70808052) has the molecular formula C23H16N2O3
and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 70808052 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(=C2N=C(c3ccccc3)C(c3ccccc3)=N2)C=CC1=O |
| InChI | InChI=1S/C23H16N2O3/c1-28-23(27)18-14-17(12-13-19(18)26)22-24-20(15-8-4-2-5-9-15)21(25-22)16-10-6-3-7-11-16/h2-14H,1H3 |
| InChIKey | SOJVUHILHOGCHJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate (CID 70808052) is methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate is COC(=O)C1=CC(=C2N=C(c3ccccc3)C(c3ccccc3)=N2)C=CC1=O.
What is the InChIKey of methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate?
The InChIKey is SOJVUHILHOGCHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O3/c1-28-23(27)18-14-17(12-13-19(18)26)22-24-20(15-8-4-2-5-9-15)21(25-22)16-10-6-3-7-11-16/h2-14H,1H3.
What are the key properties of methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate?
methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate has a molecular weight of 368.39 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4,5-diphenylimidazol-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 70808052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).