About methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate
methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 132819276) has the molecular formula C14H11IO3
and a molecular weight of 354.14 g/mol. Its IUPAC name is methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 132819276 |
| Molecular Formula | C14H11IO3 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C/C(=I\c2ccccc2)C(=O)C=C1 |
| InChI | InChI=1S/C14H11IO3/c1-18-14(17)10-7-8-13(16)12(9-10)15-11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | STIVEGFXGHIPHT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate (CID 132819276) is methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=C/C(=I\c2ccccc2)C(=O)C=C1.
What is the InChIKey of methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate?
The InChIKey is STIVEGFXGHIPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11IO3/c1-18-14(17)10-7-8-13(16)12(9-10)15-11-5-3-2-4-6-11/h2-9H,1H3.
What are the key properties of methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate?
methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate has a molecular weight of 354.14 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-3-(phenyl-λ3-iodanylidene)cyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 132819276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).