C26H22O2 — CID 10666598
methyl 4-(10b,10c-dimethylpyren-2-yl)benzoate (PubChem CID 10666598) has the molecular formula C26H22O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl 4-(10b,10c-dimethylpyren-2-yl)benzoate.
| Compound Name | methyl 4-(10b,10c-dimethylpyren-2-yl)benzoate |
|---|---|
| PubChem CID | 10666598 |
| Molecular Formula | C26H22O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | methyl 4-(10b,10c-dimethylpyren-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=CC3=CC=C4C=CC=C5C=CC(=C2)C3(C)C54C)cc1 |
| InChI | InChI=1S/C26H22O2/c1-25-20-5-4-6-21(25)12-14-23-16-19(15-22(13-11-20)26(23,25)2)17-7-9-18(10-8-17)24(27)28-3/h4-16H,1-3H3 |
| InChIKey | FVMIKIVSHDODBP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |