C30H30O4 — CID 177390283
dimethyl 10-methyl-5-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-7-propan-2-ylheptalene-1,2-dicarboxylate (PubChem CID 177390283) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is dimethyl 10-methyl-5-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-7-propan-2-ylheptalene-1,2-dicarboxylate.
| Compound Name | dimethyl 10-methyl-5-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-7-propan-2-ylheptalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177390283 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | dimethyl 10-methyl-5-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-7-propan-2-ylheptalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2=C(C)C=CC(C(C)C)=CC2=C(/C=C\C=C\c2ccccc2)C=C1 |
| InChI | InChI=1S/C30H30O4/c1-20(2)24-16-15-21(3)27-26(19-24)23(14-10-9-13-22-11-7-6-8-12-22)17-18-25(29(31)33-4)28(27)30(32)34-5/h6-20H,1-5H3/b13-9+,14-10- |
| InChIKey | IVXXYHZDUZXPNJ-ITAGJCAXSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|